C21H21B3O12S3 — CID 142383345
[4,6-bis-(4-methylphenyl)sulfonyloxy-1,3,5,2,4,6-trioxatriborinan-2-yl] 4-methylbenzenesulfonate (PubChem CID 142383345) has the molecular formula C21H21B3O12S3 and a molecular weight of 594.02 g/mol. Its IUPAC name is [4,6-bis-(4-methylphenyl)sulfonyloxy-1,3,5,2,4,6-trioxatriborinan-2-yl] 4-methylbenzenesulfonate.
| Compound Name | [4,6-bis-(4-methylphenyl)sulfonyloxy-1,3,5,2,4,6-trioxatriborinan-2-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 142383345 |
| Molecular Formula | C21H21B3O12S3 |
| Molecular Weight | 594.02 g/mol |
| Exact Mass | 594.05 |
| IUPAC Name | [4,6-bis-(4-methylphenyl)sulfonyloxy-1,3,5,2,4,6-trioxatriborinan-2-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OB2OB(OS(=O)(=O)c3ccc(C)cc3)OB(OS(=O)(=O)c3ccc(C)cc3)O2)cc1 |
| InChI | InChI=1S/C21H21B3O12S3/c1-16-4-10-19(11-5-16)37(25,26)34-22-31-23(35-38(27,28)20-12-6-17(2)7-13-20)33-24(32-22)36-39(29,30)21-14-8-18(3)9-15-21/h4-15H,1-3H3 |
| InChIKey | UTNFJXNIWXXRNV-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.02 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|