C13H19BO5S — CID 177498191
(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl) 4-methylbenzenesulfonate (PubChem CID 177498191) has the molecular formula C13H19BO5S and a molecular weight of 298.17 g/mol. Its IUPAC name is (4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl) 4-methylbenzenesulfonate.
| Compound Name | (4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 177498191 |
| Molecular Formula | C13H19BO5S |
| Molecular Weight | 298.17 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | (4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl) 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OB2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C13H19BO5S/c1-10-6-8-11(9-7-10)20(15,16)19-14-17-12(2,3)13(4,5)18-14/h6-9H,1-5H3 |
| InChIKey | VKKDAILYNQPXPJ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.17 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|