About deuteriomethyl 4-methylbenzenesulfonate
deuteriomethyl 4-methylbenzenesulfonate (PubChem CID 129134824) has the molecular formula C8H10O3S
and a molecular weight of 187.24 g/mol. Its IUPAC name is deuteriomethyl 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | deuteriomethyl 4-methylbenzenesulfonate |
| PubChem CID | 129134824 |
| Molecular Formula | C8H10O3S |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | deuteriomethyl 4-methylbenzenesulfonate |
| SMILES | [2H]COS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C8H10O3S/c1-7-3-5-8(6-4-7)12(9,10)11-2/h3-6H,1-2H3/i2D |
| InChIKey | VUQUOGPMUUJORT-VMNATFBRSA-N |
| XLogP | 1.33 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze deuteriomethyl 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of deuteriomethyl 4-methylbenzenesulfonate?
The IUPAC name of deuteriomethyl 4-methylbenzenesulfonate (CID 129134824) is deuteriomethyl 4-methylbenzenesulfonate.
What is the SMILES notation for deuteriomethyl 4-methylbenzenesulfonate?
The canonical SMILES for deuteriomethyl 4-methylbenzenesulfonate is [2H]COS(=O)(=O)c1ccc(C)cc1.
What is the InChIKey of deuteriomethyl 4-methylbenzenesulfonate?
The InChIKey is VUQUOGPMUUJORT-VMNATFBRSA-N. The full InChI is InChI=1S/C8H10O3S/c1-7-3-5-8(6-4-7)12(9,10)11-2/h3-6H,1-2H3/i2D.
What are the key properties of deuteriomethyl 4-methylbenzenesulfonate?
deuteriomethyl 4-methylbenzenesulfonate has a molecular weight of 187.24 g/mol, XLogP of 1.33, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for deuteriomethyl 4-methylbenzenesulfonate is sourced from PubChem (CID 129134824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).