C12H18O3S — CID 10014766
(1,1,1-trideuterio-3-methylbutan-2-yl) 4-methylbenzenesulfonate (PubChem CID 10014766) has the molecular formula C12H18O3S and a molecular weight of 245.36 g/mol. Its IUPAC name is (1,1,1-trideuterio-3-methylbutan-2-yl) 4-methylbenzenesulfonate.
| Compound Name | (1,1,1-trideuterio-3-methylbutan-2-yl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10014766 |
| Molecular Formula | C12H18O3S |
| Molecular Weight | 245.36 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | (1,1,1-trideuterio-3-methylbutan-2-yl) 4-methylbenzenesulfonate |
| SMILES | [2H]C([2H])([2H])C(OS(=O)(=O)c1ccc(C)cc1)C(C)C |
| InChI | InChI=1S/C12H18O3S/c1-9(2)11(4)15-16(13,14)12-7-5-10(3)6-8-12/h5-9,11H,1-4H3/i4D3 |
| InChIKey | YFRJBSSHABTVOA-GKOSEXJESA-N |
| XLogP | 2.74 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|