C13H18O5S — CID 13261107
[(2R,3S)-3-(4-methylphenyl)sulfonyloxybutan-2-yl] acetate (PubChem CID 13261107) has the molecular formula C13H18O5S and a molecular weight of 286.35 g/mol. Its IUPAC name is [(2R,3S)-3-(4-methylphenyl)sulfonyloxybutan-2-yl] acetate.
| Compound Name | [(2R,3S)-3-(4-methylphenyl)sulfonyloxybutan-2-yl] acetate |
|---|---|
| PubChem CID | 13261107 |
| Molecular Formula | C13H18O5S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | [(2R,3S)-3-(4-methylphenyl)sulfonyloxybutan-2-yl] acetate |
| SMILES | CC(=O)O[C@H](C)[C@H](C)OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C13H18O5S/c1-9-5-7-13(8-6-9)19(15,16)18-11(3)10(2)17-12(4)14/h5-8,10-11H,1-4H3/t10-,11+/m1/s1 |
| InChIKey | JWKAAJRADAZRSK-MNOVXSKESA-N |
| XLogP | 2.04 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|