C16H22O5S — CID 100989836
[(2S,3S)-3-[(4-methylphenyl)sulfonylmethyl]-4-oxohexan-2-yl] acetate (PubChem CID 100989836) has the molecular formula C16H22O5S and a molecular weight of 326.41 g/mol. Its IUPAC name is [(2S,3S)-3-[(4-methylphenyl)sulfonylmethyl]-4-oxohexan-2-yl] acetate.
| Compound Name | [(2S,3S)-3-[(4-methylphenyl)sulfonylmethyl]-4-oxohexan-2-yl] acetate |
|---|---|
| PubChem CID | 100989836 |
| Molecular Formula | C16H22O5S |
| Molecular Weight | 326.41 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | [(2S,3S)-3-[(4-methylphenyl)sulfonylmethyl]-4-oxohexan-2-yl] acetate |
| SMILES | CCC(=O)[C@@H](CS(=O)(=O)c1ccc(C)cc1)[C@H](C)OC(C)=O |
| InChI | InChI=1S/C16H22O5S/c1-5-16(18)15(12(3)21-13(4)17)10-22(19,20)14-8-6-11(2)7-9-14/h6-9,12,15H,5,10H2,1-4H3/t12-,15-/m0/s1 |
| InChIKey | JMDGJUOBIIZMHV-WFASDCNBSA-N |
| XLogP | 2.32 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |