C15H24O4S — CID 131849424
(3S,4S)-2-methyl-3-[(4-methylphenyl)sulfonylmethyl]hexane-2,4-diol (PubChem CID 131849424) has the molecular formula C15H24O4S and a molecular weight of 300.42 g/mol. Its IUPAC name is (3S,4S)-2-methyl-3-[(4-methylphenyl)sulfonylmethyl]hexane-2,4-diol.
| Compound Name | (3S,4S)-2-methyl-3-[(4-methylphenyl)sulfonylmethyl]hexane-2,4-diol |
|---|---|
| PubChem CID | 131849424 |
| Molecular Formula | C15H24O4S |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | (3S,4S)-2-methyl-3-[(4-methylphenyl)sulfonylmethyl]hexane-2,4-diol |
| SMILES | CC[C@H](O)[C@H](CS(=O)(=O)c1ccc(C)cc1)C(C)(C)O |
| InChI | InChI=1S/C15H24O4S/c1-5-14(16)13(15(3,4)17)10-20(18,19)12-8-6-11(2)7-9-12/h6-9,13-14,16-17H,5,10H2,1-4H3/t13-,14-/m0/s1 |
| InChIKey | VCQGYCOZPBNRMU-KBPBESRZSA-N |
| XLogP | 1.93 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |