C13H17FO3S — CID 23255463
(2R,3S)-3-fluoro-1-(4-methylphenyl)sulfonylhex-5-en-2-ol (PubChem CID 23255463) has the molecular formula C13H17FO3S and a molecular weight of 272.34 g/mol. Its IUPAC name is (2R,3S)-3-fluoro-1-(4-methylphenyl)sulfonylhex-5-en-2-ol.
| Compound Name | (2R,3S)-3-fluoro-1-(4-methylphenyl)sulfonylhex-5-en-2-ol |
|---|---|
| PubChem CID | 23255463 |
| Molecular Formula | C13H17FO3S |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | (2R,3S)-3-fluoro-1-(4-methylphenyl)sulfonylhex-5-en-2-ol |
| SMILES | C=CC[C@H](F)[C@@H](O)CS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C13H17FO3S/c1-3-4-12(14)13(15)9-18(16,17)11-7-5-10(2)6-8-11/h3,5-8,12-13,15H,1,4,9H2,2H3/t12-,13-/m0/s1 |
| InChIKey | YHKBTVCZFZFRLV-STQMWFEESA-N |
| XLogP | 2.04 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|