C14H18O4S — CID 157254302
methyl (2S)-3-methyl-2-[(4-methylphenyl)sulfonylmethyl]but-3-enoate (PubChem CID 157254302) has the molecular formula C14H18O4S and a molecular weight of 282.36 g/mol. Its IUPAC name is methyl (2S)-3-methyl-2-[(4-methylphenyl)sulfonylmethyl]but-3-enoate.
| Compound Name | methyl (2S)-3-methyl-2-[(4-methylphenyl)sulfonylmethyl]but-3-enoate |
|---|---|
| PubChem CID | 157254302 |
| Molecular Formula | C14H18O4S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | methyl (2S)-3-methyl-2-[(4-methylphenyl)sulfonylmethyl]but-3-enoate |
| SMILES | C=C(C)[C@H](CS(=O)(=O)c1ccc(C)cc1)C(=O)OC |
| InChI | InChI=1S/C14H18O4S/c1-10(2)13(14(15)18-4)9-19(16,17)12-7-5-11(3)6-8-12/h5-8,13H,1,9H2,2-4H3/t13-/m0/s1 |
| InChIKey | PFEUUMIQIJQMEQ-ZDUSSCGKSA-N |
| XLogP | 2.13 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|