C11H12O6S — CID 20771567
3-methoxy-2-(4-methylphenyl)sulfonyl-3-oxopropanoic acid (PubChem CID 20771567) has the molecular formula C11H12O6S and a molecular weight of 272.28 g/mol. Its IUPAC name is 3-methoxy-2-(4-methylphenyl)sulfonyl-3-oxopropanoic acid.
| Compound Name | 3-methoxy-2-(4-methylphenyl)sulfonyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 20771567 |
| Molecular Formula | C11H12O6S |
| Molecular Weight | 272.28 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 3-methoxy-2-(4-methylphenyl)sulfonyl-3-oxopropanoic acid |
| SMILES | COC(=O)C(C(=O)O)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C11H12O6S/c1-7-3-5-8(6-4-7)18(15,16)9(10(12)13)11(14)17-2/h3-6,9H,1-2H3,(H,12,13) |
| InChIKey | NFYLNAIGFKJUCS-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.28 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|