C21H26O6S — CID 102216507
1-O-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl] 3-O-methyl 2-(4-methylphenyl)sulfonylpropanedioate (PubChem CID 102216507) has the molecular formula C21H26O6S and a molecular weight of 406.50 g/mol. Its IUPAC name is 1-O-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl] 3-O-methyl 2-(4-methylphenyl)sulfonylpropanedioate.
| Compound Name | 1-O-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl] 3-O-methyl 2-(4-methylphenyl)sulfonylpropanedioate |
|---|---|
| PubChem CID | 102216507 |
| Molecular Formula | C21H26O6S |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 1-O-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl] 3-O-methyl 2-(4-methylphenyl)sulfonylpropanedioate |
| SMILES | COC(=O)C(C(=O)OCC1=CC[C@H]2C[C@@H]1C2(C)C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H26O6S/c1-13-5-9-16(10-6-13)28(24,25)18(19(22)26-4)20(23)27-12-14-7-8-15-11-17(14)21(15,2)3/h5-7,9-10,15,17-18H,8,11-12H2,1-4H3/t15-,17-,18?/m0/s1 |
| InChIKey | VRSIRIGTUKZJKO-LUIZSJORSA-N |
| XLogP | 2.85 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|