C13H24N+ — CID 14634830
(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl-trimethylazanium (PubChem CID 14634830) has the molecular formula C13H24N+ and a molecular weight of 194.34 g/mol. Its IUPAC name is (6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl-trimethylazanium.
| Compound Name | (6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl-trimethylazanium |
|---|---|
| PubChem CID | 14634830 |
| Molecular Formula | C13H24N+ |
| Molecular Weight | 194.34 g/mol |
| Exact Mass | 194.19 |
| IUPAC Name | (6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl-trimethylazanium |
| SMILES | CC1(C)C2CC=C(C[N+](C)(C)C)C1C2 |
| InChI | InChI=1S/C13H24N/c1-13(2)11-7-6-10(12(13)8-11)9-14(3,4)5/h6,11-12H,7-9H2,1-5H3/q+1 |
| InChIKey | KUDCIKDUKGNUEH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.34 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|