C20H28N2O3S — CID 102459859
(1R,6R)-9-(methoxymethyl)-3,5,5-trimethyl-2-(4-methylphenyl)sulfonyl-2,4-diazabicyclo[4.3.1]deca-3,8-diene (PubChem CID 102459859) has the molecular formula C20H28N2O3S and a molecular weight of 376.52 g/mol. Its IUPAC name is (1R,6R)-9-(methoxymethyl)-3,5,5-trimethyl-2-(4-methylphenyl)sulfonyl-2,4-diazabicyclo[4.3.1]deca-3,8-diene.
| Compound Name | (1R,6R)-9-(methoxymethyl)-3,5,5-trimethyl-2-(4-methylphenyl)sulfonyl-2,4-diazabicyclo[4.3.1]deca-3,8-diene |
|---|---|
| PubChem CID | 102459859 |
| Molecular Formula | C20H28N2O3S |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | (1R,6R)-9-(methoxymethyl)-3,5,5-trimethyl-2-(4-methylphenyl)sulfonyl-2,4-diazabicyclo[4.3.1]deca-3,8-diene |
| SMILES | COCC1=CC[C@@H]2C[C@H]1N(S(=O)(=O)c1ccc(C)cc1)C(C)=NC2(C)C |
| InChI | InChI=1S/C20H28N2O3S/c1-14-6-10-18(11-7-14)26(23,24)22-15(2)21-20(3,4)17-9-8-16(13-25-5)19(22)12-17/h6-8,10-11,17,19H,9,12-13H2,1-5H3/t17-,19-/m1/s1 |
| InChIKey | HPWOKNPZBNMLFN-IEBWSBKVSA-N |
| XLogP | 3.55 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|