C21H31NO4S — CID 102154471
5,6-bis(methoxymethyl)-3a,7-dimethyl-2-(4-methylphenyl)sulfonyl-3,4,5,6-tetrahydro-1H-isoindole (PubChem CID 102154471) has the molecular formula C21H31NO4S and a molecular weight of 393.55 g/mol. Its IUPAC name is 5,6-bis(methoxymethyl)-3a,7-dimethyl-2-(4-methylphenyl)sulfonyl-3,4,5,6-tetrahydro-1H-isoindole.
| Compound Name | 5,6-bis(methoxymethyl)-3a,7-dimethyl-2-(4-methylphenyl)sulfonyl-3,4,5,6-tetrahydro-1H-isoindole |
|---|---|
| PubChem CID | 102154471 |
| Molecular Formula | C21H31NO4S |
| Molecular Weight | 393.55 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | 5,6-bis(methoxymethyl)-3a,7-dimethyl-2-(4-methylphenyl)sulfonyl-3,4,5,6-tetrahydro-1H-isoindole |
| SMILES | COCC1CC2(C)CN(S(=O)(=O)c3ccc(C)cc3)CC2=C(C)C1COC |
| InChI | InChI=1S/C21H31NO4S/c1-15-6-8-18(9-7-15)27(23,24)22-11-20-16(2)19(13-26-5)17(12-25-4)10-21(20,3)14-22/h6-9,17,19H,10-14H2,1-5H3 |
| InChIKey | MTIVVZAWTFBQOO-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.55 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|