C19H23NO2S — CID 135006764
7,8-dimethyl-3-(4-methylphenyl)sulfonyl-3-azatetracyclo[5.3.1.01,5.05,10]undec-8-ene (PubChem CID 135006764) has the molecular formula C19H23NO2S and a molecular weight of 329.46 g/mol. Its IUPAC name is 7,8-dimethyl-3-(4-methylphenyl)sulfonyl-3-azatetracyclo[5.3.1.01,5.05,10]undec-8-ene.
| Compound Name | 7,8-dimethyl-3-(4-methylphenyl)sulfonyl-3-azatetracyclo[5.3.1.01,5.05,10]undec-8-ene |
|---|---|
| PubChem CID | 135006764 |
| Molecular Formula | C19H23NO2S |
| Molecular Weight | 329.46 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 7,8-dimethyl-3-(4-methylphenyl)sulfonyl-3-azatetracyclo[5.3.1.01,5.05,10]undec-8-ene |
| SMILES | CC1=CC2C34CN(S(=O)(=O)c5ccc(C)cc5)CC23CC1(C)C4 |
| InChI | InChI=1S/C19H23NO2S/c1-13-4-6-15(7-5-13)23(21,22)20-11-18-9-17(3)10-19(18,12-20)16(18)8-14(17)2/h4-8,16H,9-12H2,1-3H3 |
| InChIKey | IXBMNUCTQPDZGJ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.46 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|