C22H26Br4N2O4S2 — CID 10557090
3,7-dibromo-3,7-bis(bromomethyl)-1,5-bis-(4-methylphenyl)sulfonyl-1,5-diazocane (PubChem CID 10557090) has the molecular formula C22H26Br4N2O4S2 and a molecular weight of 766.21 g/mol. Its IUPAC name is 3,7-dibromo-3,7-bis(bromomethyl)-1,5-bis-(4-methylphenyl)sulfonyl-1,5-diazocane.
| Compound Name | 3,7-dibromo-3,7-bis(bromomethyl)-1,5-bis-(4-methylphenyl)sulfonyl-1,5-diazocane |
|---|---|
| PubChem CID | 10557090 |
| Molecular Formula | C22H26Br4N2O4S2 |
| Molecular Weight | 766.21 g/mol |
| Exact Mass | 761.81 |
| IUPAC Name | 3,7-dibromo-3,7-bis(bromomethyl)-1,5-bis-(4-methylphenyl)sulfonyl-1,5-diazocane |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(Br)(CBr)CN(S(=O)(=O)c3ccc(C)cc3)CC(Br)(CBr)C2)cc1 |
| InChI | InChI=1S/C22H26Br4N2O4S2/c1-17-3-7-19(8-4-17)33(29,30)27-13-21(25,11-23)15-28(16-22(26,12-24)14-27)34(31,32)20-9-5-18(2)6-10-20/h3-10H,11-16H2,1-2H3 |
| InChIKey | SPBSSXQSFHJVCF-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.21 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|