C19H28N2O2S — CID 157437716
2-azaspiro[3.3]heptane;2-(4-methylphenyl)sulfonyl-2-azaspiro[3.3]heptane (PubChem CID 157437716) has the molecular formula C19H28N2O2S and a molecular weight of 348.51 g/mol. Its IUPAC name is 2-azaspiro[3.3]heptane;2-(4-methylphenyl)sulfonyl-2-azaspiro[3.3]heptane.
| Compound Name | 2-azaspiro[3.3]heptane;2-(4-methylphenyl)sulfonyl-2-azaspiro[3.3]heptane |
|---|---|
| PubChem CID | 157437716 |
| Molecular Formula | C19H28N2O2S |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | 2-azaspiro[3.3]heptane;2-(4-methylphenyl)sulfonyl-2-azaspiro[3.3]heptane |
| SMILES | C1CC2(C1)CNC2.Cc1ccc(S(=O)(=O)N2CC3(CCC3)C2)cc1 |
| InChI | InChI=1S/C13H17NO2S.C6H11N/c1-11-3-5-12(6-4-11)17(15,16)14-9-13(10-14)7-2-8-13;1-2-6(3-1)4-7-5-6/h3-6H,2,7-10H2,1H3;7H,1-5H2 |
| InChIKey | BRHMTFKCRDHODB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |