About 2-azaspiro[3.3]heptane;4-methylbenzenesulfonic acid
2-azaspiro[3.3]heptane;4-methylbenzenesulfonic acid (PubChem CID 175981563) has the molecular formula C13H19NO3S
and a molecular weight of 269.37 g/mol. Its IUPAC name is 2-azaspiro[3.3]heptane;4-methylbenzenesulfonic acid.
Molecular Properties
| Compound Name | 2-azaspiro[3.3]heptane;4-methylbenzenesulfonic acid |
| PubChem CID | 175981563 |
| Molecular Formula | C13H19NO3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 2-azaspiro[3.3]heptane;4-methylbenzenesulfonic acid |
| SMILES | C1CC2(C1)CNC2.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C7H8O3S.C6H11N/c1-6-2-4-7(5-3-6)11(8,9)10;1-2-6(3-1)4-7-5-6/h2-5H,1H3,(H,8,9,10);7H,1-5H2 |
| InChIKey | DGEPVYNZYHWLFA-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-azaspiro[3.3]heptane;4-methylbenzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azaspiro[3.3]heptane;4-methylbenzenesulfonic acid?
The IUPAC name of 2-azaspiro[3.3]heptane;4-methylbenzenesulfonic acid (CID 175981563) is 2-azaspiro[3.3]heptane;4-methylbenzenesulfonic acid.
What is the SMILES notation for 2-azaspiro[3.3]heptane;4-methylbenzenesulfonic acid?
The canonical SMILES for 2-azaspiro[3.3]heptane;4-methylbenzenesulfonic acid is C1CC2(C1)CNC2.Cc1ccc(S(=O)(=O)O)cc1.
What is the InChIKey of 2-azaspiro[3.3]heptane;4-methylbenzenesulfonic acid?
The InChIKey is DGEPVYNZYHWLFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O3S.C6H11N/c1-6-2-4-7(5-3-6)11(8,9)10;1-2-6(3-1)4-7-5-6/h2-5H,1H3,(H,8,9,10);7H,1-5H2.
What are the key properties of 2-azaspiro[3.3]heptane;4-methylbenzenesulfonic acid?
2-azaspiro[3.3]heptane;4-methylbenzenesulfonic acid has a molecular weight of 269.37 g/mol, XLogP of 2.00, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azaspiro[3.3]heptane;4-methylbenzenesulfonic acid is sourced from PubChem (CID 175981563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).