About 4-methylbenzenesulfonic acid;6-(triazol-2-yl)-2-azaspiro[3.3]heptane
4-methylbenzenesulfonic acid;6-(triazol-2-yl)-2-azaspiro[3.3]heptane (PubChem CID 174242562) has the molecular formula C15H20N4O3S
and a molecular weight of 336.42 g/mol. Its IUPAC name is 4-methylbenzenesulfonic acid;6-(triazol-2-yl)-2-azaspiro[3.3]heptane.
Molecular Properties
| Compound Name | 4-methylbenzenesulfonic acid;6-(triazol-2-yl)-2-azaspiro[3.3]heptane |
| PubChem CID | 174242562 |
| Molecular Formula | C15H20N4O3S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 4-methylbenzenesulfonic acid;6-(triazol-2-yl)-2-azaspiro[3.3]heptane |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.c1cnn(C2CC3(CNC3)C2)n1 |
| InChI | InChI=1S/C8H12N4.C7H8O3S/c1-2-11-12(10-1)7-3-8(4-7)5-9-6-8;1-6-2-4-7(5-3-6)11(8,9)10/h1-2,7,9H,3-6H2;2-5H,1H3,(H,8,9,10) |
| InChIKey | PXBFCUFEYSVGOE-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-methylbenzenesulfonic acid;6-(triazol-2-yl)-2-azaspiro[3.3]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylbenzenesulfonic acid;6-(triazol-2-yl)-2-azaspiro[3.3]heptane?
The IUPAC name of 4-methylbenzenesulfonic acid;6-(triazol-2-yl)-2-azaspiro[3.3]heptane (CID 174242562) is 4-methylbenzenesulfonic acid;6-(triazol-2-yl)-2-azaspiro[3.3]heptane.
What is the SMILES notation for 4-methylbenzenesulfonic acid;6-(triazol-2-yl)-2-azaspiro[3.3]heptane?
The canonical SMILES for 4-methylbenzenesulfonic acid;6-(triazol-2-yl)-2-azaspiro[3.3]heptane is Cc1ccc(S(=O)(=O)O)cc1.c1cnn(C2CC3(CNC3)C2)n1.
What is the InChIKey of 4-methylbenzenesulfonic acid;6-(triazol-2-yl)-2-azaspiro[3.3]heptane?
The InChIKey is PXBFCUFEYSVGOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4.C7H8O3S/c1-2-11-12(10-1)7-3-8(4-7)5-9-6-8;1-6-2-4-7(5-3-6)11(8,9)10/h1-2,7,9H,3-6H2;2-5H,1H3,(H,8,9,10).
What are the key properties of 4-methylbenzenesulfonic acid;6-(triazol-2-yl)-2-azaspiro[3.3]heptane?
4-methylbenzenesulfonic acid;6-(triazol-2-yl)-2-azaspiro[3.3]heptane has a molecular weight of 336.42 g/mol, XLogP of 1.44, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylbenzenesulfonic acid;6-(triazol-2-yl)-2-azaspiro[3.3]heptane is sourced from PubChem (CID 174242562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).