C15H20N4O3S — CID 174242597
4-methylbenzenesulfonic acid;6-(triazol-1-yl)-2-azaspiro[3.3]heptane (PubChem CID 174242597) has the molecular formula C15H20N4O3S and a molecular weight of 336.42 g/mol. Its IUPAC name is 4-methylbenzenesulfonic acid;6-(triazol-1-yl)-2-azaspiro[3.3]heptane.
| Compound Name | 4-methylbenzenesulfonic acid;6-(triazol-1-yl)-2-azaspiro[3.3]heptane |
|---|---|
| PubChem CID | 174242597 |
| Molecular Formula | C15H20N4O3S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 4-methylbenzenesulfonic acid;6-(triazol-1-yl)-2-azaspiro[3.3]heptane |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.c1cn(C2CC3(CNC3)C2)nn1 |
| InChI | InChI=1S/C8H12N4.C7H8O3S/c1-2-12(11-10-1)7-3-8(4-7)5-9-6-8;1-6-2-4-7(5-3-6)11(8,9)10/h1-2,7,9H,3-6H2;2-5H,1H3,(H,8,9,10) |
| InChIKey | LHWYSGQTDDRYET-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|