C15H23N3O4SSi — CID 10904713
ethyl 4-(4-methylphenyl)sulfonyl-3-trimethylsilyl-1,5-dihydro-1,2,4-triazole-5-carboxylate (PubChem CID 10904713) has the molecular formula C15H23N3O4SSi and a molecular weight of 369.52 g/mol. Its IUPAC name is ethyl 4-(4-methylphenyl)sulfonyl-3-trimethylsilyl-1,5-dihydro-1,2,4-triazole-5-carboxylate.
| Compound Name | ethyl 4-(4-methylphenyl)sulfonyl-3-trimethylsilyl-1,5-dihydro-1,2,4-triazole-5-carboxylate |
|---|---|
| PubChem CID | 10904713 |
| Molecular Formula | C15H23N3O4SSi |
| Molecular Weight | 369.52 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | ethyl 4-(4-methylphenyl)sulfonyl-3-trimethylsilyl-1,5-dihydro-1,2,4-triazole-5-carboxylate |
| SMILES | CCOC(=O)C1NN=C([Si](C)(C)C)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H23N3O4SSi/c1-6-22-14(19)13-16-17-15(24(3,4)5)18(13)23(20,21)12-9-7-11(2)8-10-12/h7-10,13,16H,6H2,1-5H3 |
| InChIKey | MBIWHWZBRHZMJX-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.52 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|