C18H25NO5S — CID 14286492
ethyl (5S)-1-(4-methylphenyl)sulfonyl-5-(2-methylpropyl)-2-oxopyrrolidine-3-carboxylate (PubChem CID 14286492) has the molecular formula C18H25NO5S and a molecular weight of 367.47 g/mol. Its IUPAC name is ethyl (5S)-1-(4-methylphenyl)sulfonyl-5-(2-methylpropyl)-2-oxopyrrolidine-3-carboxylate.
| Compound Name | ethyl (5S)-1-(4-methylphenyl)sulfonyl-5-(2-methylpropyl)-2-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 14286492 |
| Molecular Formula | C18H25NO5S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | ethyl (5S)-1-(4-methylphenyl)sulfonyl-5-(2-methylpropyl)-2-oxopyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)C1C[C@H](CC(C)C)N(S(=O)(=O)c2ccc(C)cc2)C1=O |
| InChI | InChI=1S/C18H25NO5S/c1-5-24-18(21)16-11-14(10-12(2)3)19(17(16)20)25(22,23)15-8-6-13(4)7-9-15/h6-9,12,14,16H,5,10-11H2,1-4H3/t14-,16?/m0/s1 |
| InChIKey | KRYMFLNPNIJDBR-LBAUFKAWSA-N |
| XLogP | 2.51 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|