C22H30N2O6S2 — CID 2844836
2,3-diethoxy-1,4-bis-(4-methylphenyl)sulfonylpiperazine (PubChem CID 2844836) has the molecular formula C22H30N2O6S2 and a molecular weight of 482.62 g/mol. Its IUPAC name is 2,3-diethoxy-1,4-bis-(4-methylphenyl)sulfonylpiperazine.
| Compound Name | 2,3-diethoxy-1,4-bis-(4-methylphenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 2844836 |
| Molecular Formula | C22H30N2O6S2 |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | 2,3-diethoxy-1,4-bis-(4-methylphenyl)sulfonylpiperazine |
| SMILES | CCOC1C(OCC)N(S(=O)(=O)c2ccc(C)cc2)CCN1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H30N2O6S2/c1-5-29-21-22(30-6-2)24(32(27,28)20-13-9-18(4)10-14-20)16-15-23(21)31(25,26)19-11-7-17(3)8-12-19/h7-14,21-22H,5-6,15-16H2,1-4H3 |
| InChIKey | PMAVTBHKXSISNF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |