C16H25NO4S — CID 71037189
2-(butoxymethyl)-1-(4-methylphenyl)sulfonylpyrrolidin-3-ol (PubChem CID 71037189) has the molecular formula C16H25NO4S and a molecular weight of 327.45 g/mol. Its IUPAC name is 2-(butoxymethyl)-1-(4-methylphenyl)sulfonylpyrrolidin-3-ol.
| Compound Name | 2-(butoxymethyl)-1-(4-methylphenyl)sulfonylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 71037189 |
| Molecular Formula | C16H25NO4S |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 2-(butoxymethyl)-1-(4-methylphenyl)sulfonylpyrrolidin-3-ol |
| SMILES | CCCCOCC1C(O)CCN1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H25NO4S/c1-3-4-11-21-12-15-16(18)9-10-17(15)22(19,20)14-7-5-13(2)6-8-14/h5-8,15-16,18H,3-4,9-12H2,1-2H3 |
| InChIKey | WAVWTKUSQKDNCD-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|