C18H27NO3S — CID 102313913
(6S)-4-methyl-1-(4-methylphenyl)sulfonyl-6-pentoxy-3,6-dihydro-2H-pyridine (PubChem CID 102313913) has the molecular formula C18H27NO3S and a molecular weight of 337.49 g/mol. Its IUPAC name is (6S)-4-methyl-1-(4-methylphenyl)sulfonyl-6-pentoxy-3,6-dihydro-2H-pyridine.
| Compound Name | (6S)-4-methyl-1-(4-methylphenyl)sulfonyl-6-pentoxy-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 102313913 |
| Molecular Formula | C18H27NO3S |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | (6S)-4-methyl-1-(4-methylphenyl)sulfonyl-6-pentoxy-3,6-dihydro-2H-pyridine |
| SMILES | CCCCCO[C@H]1C=C(C)CCN1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H27NO3S/c1-4-5-6-13-22-18-14-16(3)11-12-19(18)23(20,21)17-9-7-15(2)8-10-17/h7-10,14,18H,4-6,11-13H2,1-3H3/t18-/m0/s1 |
| InChIKey | KVWNDPHPTNQSQW-SFHVURJKSA-N |
| XLogP | 3.87 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|