C16H22N2O4S — CID 25258678
6-butyl-4-methyl-1-(4-nitrophenyl)sulfonyl-3,6-dihydro-2H-pyridine (PubChem CID 25258678) has the molecular formula C16H22N2O4S and a molecular weight of 338.43 g/mol. Its IUPAC name is 6-butyl-4-methyl-1-(4-nitrophenyl)sulfonyl-3,6-dihydro-2H-pyridine.
| Compound Name | 6-butyl-4-methyl-1-(4-nitrophenyl)sulfonyl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 25258678 |
| Molecular Formula | C16H22N2O4S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 6-butyl-4-methyl-1-(4-nitrophenyl)sulfonyl-3,6-dihydro-2H-pyridine |
| SMILES | CCCCC1C=C(C)CCN1S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H22N2O4S/c1-3-4-5-15-12-13(2)10-11-17(15)23(21,22)16-8-6-14(7-9-16)18(19)20/h6-9,12,15H,3-5,10-11H2,1-2H3 |
| InChIKey | NCBHSGVTOFFIRV-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|