C15H20N2O7S — CID 51050517
butyl 2-[3-(4-nitrophenyl)sulfonyl-1,3-oxazolidin-2-yl]acetate (PubChem CID 51050517) has the molecular formula C15H20N2O7S and a molecular weight of 372.40 g/mol. Its IUPAC name is butyl 2-[3-(4-nitrophenyl)sulfonyl-1,3-oxazolidin-2-yl]acetate.
| Compound Name | butyl 2-[3-(4-nitrophenyl)sulfonyl-1,3-oxazolidin-2-yl]acetate |
|---|---|
| PubChem CID | 51050517 |
| Molecular Formula | C15H20N2O7S |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | butyl 2-[3-(4-nitrophenyl)sulfonyl-1,3-oxazolidin-2-yl]acetate |
| SMILES | CCCCOC(=O)CC1OCCN1S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H20N2O7S/c1-2-3-9-24-15(18)11-14-16(8-10-23-14)25(21,22)13-6-4-12(5-7-13)17(19)20/h4-7,14H,2-3,8-11H2,1H3 |
| InChIKey | RSDFDEWGDSLJII-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|