C12H15N3O5S — CID 178194886
(4aR,7aS)-4-(4-nitrophenyl)sulfonyl-3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine (PubChem CID 178194886) has the molecular formula C12H15N3O5S and a molecular weight of 313.33 g/mol. Its IUPAC name is (4aR,7aS)-4-(4-nitrophenyl)sulfonyl-3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine.
| Compound Name | (4aR,7aS)-4-(4-nitrophenyl)sulfonyl-3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine |
|---|---|
| PubChem CID | 178194886 |
| Molecular Formula | C12H15N3O5S |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | (4aR,7aS)-4-(4-nitrophenyl)sulfonyl-3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)N2CCO[C@H]3CNC[C@H]32)cc1 |
| InChI | InChI=1S/C12H15N3O5S/c16-15(17)9-1-3-10(4-2-9)21(18,19)14-5-6-20-12-8-13-7-11(12)14/h1-4,11-13H,5-8H2/t11-,12+/m1/s1 |
| InChIKey | NLVDPYSJUVRWQF-NEPJUHHUSA-N |
| XLogP | -0.04 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|