C11H19ClN4O3S — CID 120778335
(4aR,7aS)-4-(2-ethylpyrazol-3-yl)sulfonyl-3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine;hydrochloride (PubChem CID 120778335) has the molecular formula C11H19ClN4O3S and a molecular weight of 322.82 g/mol. Its IUPAC name is (4aR,7aS)-4-(2-ethylpyrazol-3-yl)sulfonyl-3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine;hydrochloride.
| Compound Name | (4aR,7aS)-4-(2-ethylpyrazol-3-yl)sulfonyl-3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine;hydrochloride |
|---|---|
| PubChem CID | 120778335 |
| Molecular Formula | C11H19ClN4O3S |
| Molecular Weight | 322.82 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | (4aR,7aS)-4-(2-ethylpyrazol-3-yl)sulfonyl-3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine;hydrochloride |
| SMILES | CCn1nccc1S(=O)(=O)N1CCO[C@H]2CNC[C@H]21.Cl |
| InChI | InChI=1S/C11H18N4O3S.ClH/c1-2-14-11(3-4-13-14)19(16,17)15-5-6-18-10-8-12-7-9(10)15;/h3-4,9-10,12H,2,5-8H2,1H3;1H/t9-,10+;/m1./s1 |
| InChIKey | RMTKHWHKMYPNFH-UXQCFNEQSA-N |
| XLogP | -0.31 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.82 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |