C24H32N2O5S2 — CID 165355383
1-(4-methylphenyl)sulfonyl-2-[2-[2-[1-(4-methylphenyl)sulfonylazetidin-2-yl]ethoxy]ethyl]azetidine (PubChem CID 165355383) has the molecular formula C24H32N2O5S2 and a molecular weight of 492.66 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-2-[2-[2-[1-(4-methylphenyl)sulfonylazetidin-2-yl]ethoxy]ethyl]azetidine.
| Compound Name | 1-(4-methylphenyl)sulfonyl-2-[2-[2-[1-(4-methylphenyl)sulfonylazetidin-2-yl]ethoxy]ethyl]azetidine |
|---|---|
| PubChem CID | 165355383 |
| Molecular Formula | C24H32N2O5S2 |
| Molecular Weight | 492.66 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-2-[2-[2-[1-(4-methylphenyl)sulfonylazetidin-2-yl]ethoxy]ethyl]azetidine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC2CCOCCC2CCN2S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H32N2O5S2/c1-19-3-7-23(8-4-19)32(27,28)25-15-11-21(25)13-17-31-18-14-22-12-16-26(22)33(29,30)24-9-5-20(2)6-10-24/h3-10,21-22H,11-18H2,1-2H3 |
| InChIKey | HKAVPPLAXREFKO-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.66 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|