C12H16N4O2S — CID 23986304
(2S)-2-(azidomethyl)-1-(4-methylphenyl)sulfonylpyrrolidine (PubChem CID 23986304) has the molecular formula C12H16N4O2S and a molecular weight of 280.35 g/mol. Its IUPAC name is (2S)-2-(azidomethyl)-1-(4-methylphenyl)sulfonylpyrrolidine.
| Compound Name | (2S)-2-(azidomethyl)-1-(4-methylphenyl)sulfonylpyrrolidine |
|---|---|
| PubChem CID | 23986304 |
| Molecular Formula | C12H16N4O2S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | (2S)-2-(azidomethyl)-1-(4-methylphenyl)sulfonylpyrrolidine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC[C@H]2CN=[N+]=[N-])cc1 |
| InChI | InChI=1S/C12H16N4O2S/c1-10-4-6-12(7-5-10)19(17,18)16-8-2-3-11(16)9-14-15-13/h4-7,11H,2-3,8-9H2,1H3/t11-/m0/s1 |
| InChIKey | CPNQBAVFTMTHMA-NSHDSACASA-N |
| XLogP | 2.46 |
| TPSA | 86.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|