C27H38N2O6S2 — CID 171349964
(2S)-1-(4-methylphenyl)sulfonyl-2-[2-[2-[(2S)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]ethoxymethoxy]ethyl]pyrrolidine (PubChem CID 171349964) has the molecular formula C27H38N2O6S2 and a molecular weight of 550.74 g/mol. Its IUPAC name is (2S)-1-(4-methylphenyl)sulfonyl-2-[2-[2-[(2S)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]ethoxymethoxy]ethyl]pyrrolidine.
| Compound Name | (2S)-1-(4-methylphenyl)sulfonyl-2-[2-[2-[(2S)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]ethoxymethoxy]ethyl]pyrrolidine |
|---|---|
| PubChem CID | 171349964 |
| Molecular Formula | C27H38N2O6S2 |
| Molecular Weight | 550.74 g/mol |
| Exact Mass | 550.22 |
| IUPAC Name | (2S)-1-(4-methylphenyl)sulfonyl-2-[2-[2-[(2S)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]ethoxymethoxy]ethyl]pyrrolidine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC[C@H]2CCOCOCC[C@@H]2CCCN2S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C27H38N2O6S2/c1-22-7-11-26(12-8-22)36(30,31)28-17-3-5-24(28)15-19-34-21-35-20-16-25-6-4-18-29(25)37(32,33)27-13-9-23(2)10-14-27/h7-14,24-25H,3-6,15-21H2,1-2H3/t24-,25-/m0/s1 |
| InChIKey | DWHCQUVIDXYJGT-DQEYMECFSA-N |
| XLogP | 4.08 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.74 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|