C22H29NO3S — CID 134838395
(2R)-1-(4-methylphenyl)sulfonyl-2-(3-phenylmethoxypropyl)piperidine (PubChem CID 134838395) has the molecular formula C22H29NO3S and a molecular weight of 387.55 g/mol. Its IUPAC name is (2R)-1-(4-methylphenyl)sulfonyl-2-(3-phenylmethoxypropyl)piperidine.
| Compound Name | (2R)-1-(4-methylphenyl)sulfonyl-2-(3-phenylmethoxypropyl)piperidine |
|---|---|
| PubChem CID | 134838395 |
| Molecular Formula | C22H29NO3S |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | (2R)-1-(4-methylphenyl)sulfonyl-2-(3-phenylmethoxypropyl)piperidine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCC[C@@H]2CCCOCc2ccccc2)cc1 |
| InChI | InChI=1S/C22H29NO3S/c1-19-12-14-22(15-13-19)27(24,25)23-16-6-5-10-21(23)11-7-17-26-18-20-8-3-2-4-9-20/h2-4,8-9,12-15,21H,5-7,10-11,16-18H2,1H3/t21-/m1/s1 |
| InChIKey | UQSFTAGJKWBNJE-OAQYLSRUSA-N |
| XLogP | 4.54 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|