C19H23NO4S — CID 102469621
[(2R,3R)-1-(4-methylphenyl)sulfonyl-3-(2-phenylmethoxyethyl)aziridin-2-yl]methanol (PubChem CID 102469621) has the molecular formula C19H23NO4S and a molecular weight of 361.46 g/mol. Its IUPAC name is [(2R,3R)-1-(4-methylphenyl)sulfonyl-3-(2-phenylmethoxyethyl)aziridin-2-yl]methanol.
| Compound Name | [(2R,3R)-1-(4-methylphenyl)sulfonyl-3-(2-phenylmethoxyethyl)aziridin-2-yl]methanol |
|---|---|
| PubChem CID | 102469621 |
| Molecular Formula | C19H23NO4S |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | [(2R,3R)-1-(4-methylphenyl)sulfonyl-3-(2-phenylmethoxyethyl)aziridin-2-yl]methanol |
| SMILES | Cc1ccc(S(=O)(=O)N2[C@H](CCOCc3ccccc3)[C@@H]2CO)cc1 |
| InChI | InChI=1S/C19H23NO4S/c1-15-7-9-17(10-8-15)25(22,23)20-18(19(20)13-21)11-12-24-14-16-5-3-2-4-6-16/h2-10,18-19,21H,11-14H2,1H3/t18-,19+,20?/m1/s1 |
| InChIKey | IEJJOCGYYQEQBQ-LFPSWIHMSA-N |
| XLogP | 2.34 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|