C24H31NO5S — CID 15519452
(3aR,7R,7aS)-2,2-dimethyl-5-(4-methylphenyl)sulfonyl-7-(2-phenylmethoxyethyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine (PubChem CID 15519452) has the molecular formula C24H31NO5S and a molecular weight of 445.58 g/mol. Its IUPAC name is (3aR,7R,7aS)-2,2-dimethyl-5-(4-methylphenyl)sulfonyl-7-(2-phenylmethoxyethyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine.
| Compound Name | (3aR,7R,7aS)-2,2-dimethyl-5-(4-methylphenyl)sulfonyl-7-(2-phenylmethoxyethyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine |
|---|---|
| PubChem CID | 15519452 |
| Molecular Formula | C24H31NO5S |
| Molecular Weight | 445.58 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | (3aR,7R,7aS)-2,2-dimethyl-5-(4-methylphenyl)sulfonyl-7-(2-phenylmethoxyethyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@@H](CCOCc3ccccc3)[C@@H]3OC(C)(C)O[C@@H]3C2)cc1 |
| InChI | InChI=1S/C24H31NO5S/c1-18-9-11-21(12-10-18)31(26,27)25-15-20(23-22(16-25)29-24(2,3)30-23)13-14-28-17-19-7-5-4-6-8-19/h4-12,20,22-23H,13-17H2,1-3H3/t20-,22-,23+/m1/s1 |
| InChIKey | KUYIHOVWQNJUIQ-MZYLBHOOSA-N |
| XLogP | 3.74 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.58 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|