C26H34O7S — CID 11081484
[(3aS,5R,6aS)-2,2-dimethyl-3a-(4-phenylmethoxybutyl)-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-5-yl]methyl 4-methylbenzenesulfonate (PubChem CID 11081484) has the molecular formula C26H34O7S and a molecular weight of 490.62 g/mol. Its IUPAC name is [(3aS,5R,6aS)-2,2-dimethyl-3a-(4-phenylmethoxybutyl)-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-5-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(3aS,5R,6aS)-2,2-dimethyl-3a-(4-phenylmethoxybutyl)-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-5-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11081484 |
| Molecular Formula | C26H34O7S |
| Molecular Weight | 490.62 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | [(3aS,5R,6aS)-2,2-dimethyl-3a-(4-phenylmethoxybutyl)-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-5-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2C[C@@H]3OC(C)(C)O[C@]3(CCCCOCc3ccccc3)O2)cc1 |
| InChI | InChI=1S/C26H34O7S/c1-20-11-13-23(14-12-20)34(27,28)30-19-22-17-24-26(31-22,33-25(2,3)32-24)15-7-8-16-29-18-21-9-5-4-6-10-21/h4-6,9-14,22,24H,7-8,15-19H2,1-3H3/t22-,24+,26+/m1/s1 |
| InChIKey | XNMPDQANAUGAQV-CWDLOFLHSA-N |
| XLogP | 4.72 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.62 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|