C28H32O7S2 — CID 170430124
4-[2-[2-[(4-methylphenyl)sulfonyloxymethyl]-4-phenylmethoxycyclopentyl]ethyl]benzenesulfonic acid (PubChem CID 170430124) has the molecular formula C28H32O7S2 and a molecular weight of 544.69 g/mol. Its IUPAC name is 4-[2-[2-[(4-methylphenyl)sulfonyloxymethyl]-4-phenylmethoxycyclopentyl]ethyl]benzenesulfonic acid.
| Compound Name | 4-[2-[2-[(4-methylphenyl)sulfonyloxymethyl]-4-phenylmethoxycyclopentyl]ethyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 170430124 |
| Molecular Formula | C28H32O7S2 |
| Molecular Weight | 544.69 g/mol |
| Exact Mass | 544.16 |
| IUPAC Name | 4-[2-[2-[(4-methylphenyl)sulfonyloxymethyl]-4-phenylmethoxycyclopentyl]ethyl]benzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)OCC2CC(OCc3ccccc3)CC2CCc2ccc(S(=O)(=O)O)cc2)cc1 |
| InChI | InChI=1S/C28H32O7S2/c1-21-7-13-28(14-8-21)37(32,33)35-20-25-18-26(34-19-23-5-3-2-4-6-23)17-24(25)12-9-22-10-15-27(16-11-22)36(29,30)31/h2-8,10-11,13-16,24-26H,9,12,17-20H2,1H3,(H,29,30,31) |
| InChIKey | ARUAOVYQPCLWJP-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.69 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|