C22H25NO4S — CID 86730908
(1-cyano-4-phenylmethoxycyclohexyl)methyl 4-methylbenzenesulfonate (PubChem CID 86730908) has the molecular formula C22H25NO4S and a molecular weight of 399.51 g/mol. Its IUPAC name is (1-cyano-4-phenylmethoxycyclohexyl)methyl 4-methylbenzenesulfonate.
| Compound Name | (1-cyano-4-phenylmethoxycyclohexyl)methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 86730908 |
| Molecular Formula | C22H25NO4S |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | (1-cyano-4-phenylmethoxycyclohexyl)methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2(C#N)CCC(OCc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C22H25NO4S/c1-18-7-9-21(10-8-18)28(24,25)27-17-22(16-23)13-11-20(12-14-22)26-15-19-5-3-2-4-6-19/h2-10,20H,11-15,17H2,1H3 |
| InChIKey | VUTWPDSUWPTKDT-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|