C27H30O8S — CID 86606724
[(2R,3S,4R,5R)-2-hydroxy-5-(hydroxymethyl)-3,4-bis(phenylmethoxy)oxolan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 86606724) has the molecular formula C27H30O8S and a molecular weight of 514.60 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-2-hydroxy-5-(hydroxymethyl)-3,4-bis(phenylmethoxy)oxolan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2R,3S,4R,5R)-2-hydroxy-5-(hydroxymethyl)-3,4-bis(phenylmethoxy)oxolan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 86606724 |
| Molecular Formula | C27H30O8S |
| Molecular Weight | 514.60 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | [(2R,3S,4R,5R)-2-hydroxy-5-(hydroxymethyl)-3,4-bis(phenylmethoxy)oxolan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@]2(O)O[C@H](CO)[C@@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C27H30O8S/c1-20-12-14-23(15-13-20)36(30,31)34-19-27(29)26(33-18-22-10-6-3-7-11-22)25(24(16-28)35-27)32-17-21-8-4-2-5-9-21/h2-15,24-26,28-29H,16-19H2,1H3/t24-,25-,26+,27-/m1/s1 |
| InChIKey | BMEAWFHZMKTRBK-JVYGEBFASA-N |
| XLogP | 2.95 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.60 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|