C25H28O4S — CID 15328769
5-(4-phenylmethoxyphenyl)pentyl 4-methylbenzenesulfonate (PubChem CID 15328769) has the molecular formula C25H28O4S and a molecular weight of 424.56 g/mol. Its IUPAC name is 5-(4-phenylmethoxyphenyl)pentyl 4-methylbenzenesulfonate.
| Compound Name | 5-(4-phenylmethoxyphenyl)pentyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 15328769 |
| Molecular Formula | C25H28O4S |
| Molecular Weight | 424.56 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 5-(4-phenylmethoxyphenyl)pentyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCCCc2ccc(OCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C25H28O4S/c1-21-11-17-25(18-12-21)30(26,27)29-19-7-3-6-8-22-13-15-24(16-14-22)28-20-23-9-4-2-5-10-23/h2,4-5,9-18H,3,6-8,19-20H2,1H3 |
| InChIKey | VEJNTJTVYSVQPA-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.56 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|