C32H37ClO6S2 — CID 159535184
4-methylbenzenesulfonyl chloride;3-phenylpropan-1-ol;3-phenylpropyl 4-methylbenzenesulfonate (PubChem CID 159535184) has the molecular formula C32H37ClO6S2 and a molecular weight of 617.23 g/mol. Its IUPAC name is 4-methylbenzenesulfonyl chloride;3-phenylpropan-1-ol;3-phenylpropyl 4-methylbenzenesulfonate.
| Compound Name | 4-methylbenzenesulfonyl chloride;3-phenylpropan-1-ol;3-phenylpropyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 159535184 |
| Molecular Formula | C32H37ClO6S2 |
| Molecular Weight | 617.23 g/mol |
| Exact Mass | 616.17 |
| IUPAC Name | 4-methylbenzenesulfonyl chloride;3-phenylpropan-1-ol;3-phenylpropyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Cl)cc1.Cc1ccc(S(=O)(=O)OCCCc2ccccc2)cc1.OCCCc1ccccc1 |
| InChI | InChI=1S/C16H18O3S.C9H12O.C7H7ClO2S/c1-14-9-11-16(12-10-14)20(17,18)19-13-5-8-15-6-3-2-4-7-15;10-8-4-7-9-5-2-1-3-6-9;1-6-2-4-7(5-3-6)11(8,9)10/h2-4,6-7,9-12H,5,8,13H2,1H3;1-3,5-6,10H,4,7-8H2;2-5H,1H3 |
| InChIKey | MDMODKGCCYETDL-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.23 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|