C23H21NO4S — CID 19420776
3-[4-(1,3-benzoxazol-2-yl)phenyl]propyl 4-methylbenzenesulfonate (PubChem CID 19420776) has the molecular formula C23H21NO4S and a molecular weight of 407.49 g/mol. Its IUPAC name is 3-[4-(1,3-benzoxazol-2-yl)phenyl]propyl 4-methylbenzenesulfonate.
| Compound Name | 3-[4-(1,3-benzoxazol-2-yl)phenyl]propyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 19420776 |
| Molecular Formula | C23H21NO4S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 3-[4-(1,3-benzoxazol-2-yl)phenyl]propyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCc2ccc(-c3nc4ccccc4o3)cc2)cc1 |
| InChI | InChI=1S/C23H21NO4S/c1-17-8-14-20(15-9-17)29(25,26)27-16-4-5-18-10-12-19(13-11-18)23-24-21-6-2-3-7-22(21)28-23/h2-3,6-15H,4-5,16H2,1H3 |
| InChIKey | FXXLZSKGWDCUBU-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|