C28H38O3S — CID 155721797
1-[5-(benzenesulfonyl)pentyl]-4-phenylmethoxybenzene;ethane (PubChem CID 155721797) has the molecular formula C28H38O3S and a molecular weight of 454.68 g/mol. Its IUPAC name is 1-[5-(benzenesulfonyl)pentyl]-4-phenylmethoxybenzene;ethane.
| Compound Name | 1-[5-(benzenesulfonyl)pentyl]-4-phenylmethoxybenzene;ethane |
|---|---|
| PubChem CID | 155721797 |
| Molecular Formula | C28H38O3S |
| Molecular Weight | 454.68 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | 1-[5-(benzenesulfonyl)pentyl]-4-phenylmethoxybenzene;ethane |
| SMILES | CC.CC.O=S(=O)(CCCCCc1ccc(OCc2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H26O3S.2C2H6/c25-28(26,24-13-7-2-8-14-24)19-9-3-6-10-21-15-17-23(18-16-21)27-20-22-11-4-1-5-12-22;2*1-2/h1-2,4-5,7-8,11-18H,3,6,9-10,19-20H2;2*1-2H3 |
| InChIKey | AJNPGNYEMBRMRD-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.68 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|