C17H22N2O3S — CID 110612296
N-(methylsulfamoyl)-3-(4-phenylmethoxyphenyl)propan-1-amine (PubChem CID 110612296) has the molecular formula C17H22N2O3S and a molecular weight of 334.44 g/mol. Its IUPAC name is N-(methylsulfamoyl)-3-(4-phenylmethoxyphenyl)propan-1-amine.
| Compound Name | N-(methylsulfamoyl)-3-(4-phenylmethoxyphenyl)propan-1-amine |
|---|---|
| PubChem CID | 110612296 |
| Molecular Formula | C17H22N2O3S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | N-(methylsulfamoyl)-3-(4-phenylmethoxyphenyl)propan-1-amine |
| SMILES | CNS(=O)(=O)NCCCc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C17H22N2O3S/c1-18-23(20,21)19-13-5-8-15-9-11-17(12-10-15)22-14-16-6-3-2-4-7-16/h2-4,6-7,9-12,18-19H,5,8,13-14H2,1H3 |
| InChIKey | AXCVLQQNAJDTIQ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|