C20H27NO — CID 56995593
2-methyl-N-[3-(4-phenylmethoxyphenyl)propyl]propan-2-amine (PubChem CID 56995593) has the molecular formula C20H27NO and a molecular weight of 297.44 g/mol. Its IUPAC name is 2-methyl-N-[3-(4-phenylmethoxyphenyl)propyl]propan-2-amine.
| Compound Name | 2-methyl-N-[3-(4-phenylmethoxyphenyl)propyl]propan-2-amine |
|---|---|
| PubChem CID | 56995593 |
| Molecular Formula | C20H27NO |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | 2-methyl-N-[3-(4-phenylmethoxyphenyl)propyl]propan-2-amine |
| SMILES | CC(C)(C)NCCCc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C20H27NO/c1-20(2,3)21-15-7-10-17-11-13-19(14-12-17)22-16-18-8-5-4-6-9-18/h4-6,8-9,11-14,21H,7,10,15-16H2,1-3H3 |
| InChIKey | VPURIDUGHIMXJN-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|