C16H18O3S — CID 54270820
1-methoxy-4-(3-phenylpropylsulfonyl)benzene (PubChem CID 54270820) has the molecular formula C16H18O3S and a molecular weight of 290.38 g/mol. Its IUPAC name is 1-methoxy-4-(3-phenylpropylsulfonyl)benzene.
| Compound Name | 1-methoxy-4-(3-phenylpropylsulfonyl)benzene |
|---|---|
| PubChem CID | 54270820 |
| Molecular Formula | C16H18O3S |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 1-methoxy-4-(3-phenylpropylsulfonyl)benzene |
| SMILES | COc1ccc(S(=O)(=O)CCCc2ccccc2)cc1 |
| InChI | InChI=1S/C16H18O3S/c1-19-15-9-11-16(12-10-15)20(17,18)13-5-8-14-6-3-2-4-7-14/h2-4,6-7,9-12H,5,8,13H2,1H3 |
| InChIKey | RJZLAGQBPFFCHR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |