C18H21NO5S2 — CID 72718921
3-(4-methoxyphenyl)sulfonyl-1-(2-phenylethylsulfonyl)azetidine (PubChem CID 72718921) has the molecular formula C18H21NO5S2 and a molecular weight of 395.50 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)sulfonyl-1-(2-phenylethylsulfonyl)azetidine.
| Compound Name | 3-(4-methoxyphenyl)sulfonyl-1-(2-phenylethylsulfonyl)azetidine |
|---|---|
| PubChem CID | 72718921 |
| Molecular Formula | C18H21NO5S2 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | 3-(4-methoxyphenyl)sulfonyl-1-(2-phenylethylsulfonyl)azetidine |
| SMILES | COc1ccc(S(=O)(=O)C2CN(S(=O)(=O)CCc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C18H21NO5S2/c1-24-16-7-9-17(10-8-16)26(22,23)18-13-19(14-18)25(20,21)12-11-15-5-3-2-4-6-15/h2-10,18H,11-14H2,1H3 |
| InChIKey | MLIWSMRATUZNCA-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |