C20H22O5S — CID 101410026
[(2S,6S)-6-phenylmethoxy-3,6-dihydro-2H-pyran-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 101410026) has the molecular formula C20H22O5S and a molecular weight of 374.46 g/mol. Its IUPAC name is [(2S,6S)-6-phenylmethoxy-3,6-dihydro-2H-pyran-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2S,6S)-6-phenylmethoxy-3,6-dihydro-2H-pyran-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 101410026 |
| Molecular Formula | C20H22O5S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | [(2S,6S)-6-phenylmethoxy-3,6-dihydro-2H-pyran-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H]2CC=C[C@@H](OCc3ccccc3)O2)cc1 |
| InChI | InChI=1S/C20H22O5S/c1-16-10-12-19(13-11-16)26(21,22)24-15-18-8-5-9-20(25-18)23-14-17-6-3-2-4-7-17/h2-7,9-13,18,20H,8,14-15H2,1H3/t18-,20-/m0/s1 |
| InChIKey | VJLDAVWFWVMTCU-ICSRJNTNSA-N |
| XLogP | 3.59 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|