C23H29NO3S — CID 101360457
(2R,5S)-3-methyl-1-(4-methylphenyl)sulfonyl-2-(phenylmethoxymethyl)-5-propan-2-yl-2,5-dihydropyrrole (PubChem CID 101360457) has the molecular formula C23H29NO3S and a molecular weight of 399.56 g/mol. Its IUPAC name is (2R,5S)-3-methyl-1-(4-methylphenyl)sulfonyl-2-(phenylmethoxymethyl)-5-propan-2-yl-2,5-dihydropyrrole.
| Compound Name | (2R,5S)-3-methyl-1-(4-methylphenyl)sulfonyl-2-(phenylmethoxymethyl)-5-propan-2-yl-2,5-dihydropyrrole |
|---|---|
| PubChem CID | 101360457 |
| Molecular Formula | C23H29NO3S |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | (2R,5S)-3-methyl-1-(4-methylphenyl)sulfonyl-2-(phenylmethoxymethyl)-5-propan-2-yl-2,5-dihydropyrrole |
| SMILES | CC1=C[C@H](C(C)C)N(S(=O)(=O)c2ccc(C)cc2)[C@H]1COCc1ccccc1 |
| InChI | InChI=1S/C23H29NO3S/c1-17(2)22-14-19(4)23(16-27-15-20-8-6-5-7-9-20)24(22)28(25,26)21-12-10-18(3)11-13-21/h5-14,17,22-23H,15-16H2,1-4H3/t22-,23+/m1/s1 |
| InChIKey | HREHCHXMHOOTOJ-PKTZIBPZSA-N |
| XLogP | 4.56 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|