C23H29NO6S2 — CID 10672351
[(2R,6S)-5-methyl-1-(4-methylphenyl)sulfonyl-6-(phenylmethoxymethyl)-3,6-dihydro-2H-pyridin-2-yl]methyl methanesulfonate (PubChem CID 10672351) has the molecular formula C23H29NO6S2 and a molecular weight of 479.62 g/mol. Its IUPAC name is [(2R,6S)-5-methyl-1-(4-methylphenyl)sulfonyl-6-(phenylmethoxymethyl)-3,6-dihydro-2H-pyridin-2-yl]methyl methanesulfonate.
| Compound Name | [(2R,6S)-5-methyl-1-(4-methylphenyl)sulfonyl-6-(phenylmethoxymethyl)-3,6-dihydro-2H-pyridin-2-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 10672351 |
| Molecular Formula | C23H29NO6S2 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | [(2R,6S)-5-methyl-1-(4-methylphenyl)sulfonyl-6-(phenylmethoxymethyl)-3,6-dihydro-2H-pyridin-2-yl]methyl methanesulfonate |
| SMILES | CC1=CC[C@H](COS(C)(=O)=O)N(S(=O)(=O)c2ccc(C)cc2)[C@@H]1COCc1ccccc1 |
| InChI | InChI=1S/C23H29NO6S2/c1-18-9-13-22(14-10-18)32(27,28)24-21(16-30-31(3,25)26)12-11-19(2)23(24)17-29-15-20-7-5-4-6-8-20/h4-11,13-14,21,23H,12,15-17H2,1-3H3/t21-,23-/m1/s1 |
| InChIKey | LVPDDMSQLVKKSZ-FYYLOGMGSA-N |
| XLogP | 3.27 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|